| Name | pentafluorophenyl acetate |
| Synonyms | NSC 168737 Perfluorophenyl acetate perfluorophenyl acetate Pentafluorophenyl Acete PENTAFLUOROPHENYL ACETATE pentafluorophenyl acetate acetic acid pentafluorophenyl ester Phenol,2,3,4,5,6-pentafluoro-, 1-acetate Acetic acid 2,3,4,5,6-pentafluorophenyl ester |
| CAS | 19220-93-0 |
| EINECS | 242-891-0 |
| InChI | InChI=1/C8H3F5O2/c1-2(14)15-8-6(12)4(10)3(9)5(11)7(8)13/h1H3 |
| Molecular Formula | C8H3F5O2 |
| Molar Mass | 226.1 |
| Density | 1.526±0.06 g/cm3(Predicted) |
| Melting Point | 27-30°C |
| Boling Point | 59-60°C12mm Hg |
| Flash Point | 70.8°C |
| Solubility | soluble in Methanol |
| Vapor Presure | 0.63mmHg at 25°C |
| Appearance | powder to lump |
| Color | White to Almost white |
| BRN | 1985849 |
| Storage Condition | Inert atmosphere,2-8°C |
| Refractive Index | 1.421 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 10-21 |